Folder restructuring from primedev (#624)v1.21.2-rc3v1.21.2

Copies of over the primedev folder structure for easier cherry-picking of further changes

Co-authored-by: F1F7Y <filip.bartos07@proton.me>

1 files changed, 85 insertions, 0 deletions

diff --git a/primedev/logging/sourceconsole.h b/primedev/logging/sourceconsole.h
new file mode 100644
index 00000000..44d73843
--- /dev/null
+++ b/primedev/logging/sourceconsole.h
@@ -0,0 +1,85 @@
+#pragma once
+#include "core/sourceinterface.h"
+#include "spdlog/sinks/base_sink.h"
+#include <map>
+
+class EditablePanel
+{
+public:
+	virtual ~EditablePanel() = 0;
+	unsigned char unknown[0x2B0];
+};
+
+class IConsoleDisplayFunc
+{
+public:
+	virtual void ColorPrint(const SourceColor& clr, const char* pMessage) = 0;
+	virtual void Print(const char* pMessage) = 0;
+	virtual void DPrint(const char* pMessage) = 0;
+};
+
+class CConsolePanel : public EditablePanel, public IConsoleDisplayFunc
+{
+};
+
+class CConsoleDialog
+{
+public:
+	struct VTable
+	{
+		void* unknown[298];
+		void (*OnCommandSubmitted)(CConsoleDialog* consoleDialog, const char* pCommand);
+	};
+
+	VTable* m_vtable;
+	unsigned char unknown[0x398];
+	CConsolePanel* m_pConsolePanel;
+};
+
+class CGameConsole
+{
+public:
+	virtual ~CGameConsole() = 0;
+
+	// activates the console, makes it visible and brings it to the foreground
+	virtual void Activate() = 0;
+
+	virtual void Initialize() = 0;
+
+	// hides the console
+	virtual void Hide() = 0;
+
+	// clears the console
+	virtual void Clear() = 0;
+
+	// return true if the console has focus
+	virtual bool IsConsoleVisible() = 0;
+
+	virtual void SetParent(int parent) = 0;
+
+	bool m_bInitialized;
+	CConsoleDialog* m_pConsole;
+};
+
+extern SourceInterface<CGameConsole>* g_pSourceGameConsole;
+
+// spdlog logger
+class SourceConsoleSink : public CustomSink
+{
+private:
+	std::map<spdlog::level::level_enum, SourceColor> m_LogColours = {
+		{spdlog::level::trace, NS::Colors::TRACE.ToSourceColor()},
+		{spdlog::level::debug, NS::Colors::DEBUG.ToSourceColor()},
+		{spdlog::level::info, NS::Colors::INFO.ToSourceColor()},
+		{spdlog::level::warn, NS::Colors::WARN.ToSourceColor()},
+		{spdlog::level::err, NS::Colors::ERR.ToSourceColor()},
+		{spdlog::level::critical, NS::Colors::CRIT.ToSourceColor()},
+		{spdlog::level::off, NS::Colors::OFF.ToSourceColor()}};
+
+protected:
+	void custom_sink_it_(const custom_log_msg& msg);
+	void sink_it_(const spdlog::details::log_msg& msg) override;
+	void flush_() override;
+};
+
+void InitialiseConsoleOnInterfaceCreation();